C12H18O4 — CID 165047027
3-butan-2-yl-6-ethylbenzene-1,2,4,5-tetrol (PubChem CID 165047027) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-butan-2-yl-6-ethylbenzene-1,2,4,5-tetrol.
| Compound Name | 3-butan-2-yl-6-ethylbenzene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 165047027 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-butan-2-yl-6-ethylbenzene-1,2,4,5-tetrol |
| SMILES | CCc1c(O)c(O)c(C(C)CC)c(O)c1O |
| InChI | InChI=1S/C12H18O4/c1-4-6(3)8-11(15)9(13)7(5-2)10(14)12(8)16/h6,13-16H,4-5H2,1-3H3 |
| InChIKey | PBNOKTYSPBKKAD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|