C11H13Cl2FO — CID 167081741
2-butan-2-yl-4,6-dichloro-5-fluoro-3-methylphenol (PubChem CID 167081741) has the molecular formula C11H13Cl2FO and a molecular weight of 251.13 g/mol. Its IUPAC name is 2-butan-2-yl-4,6-dichloro-5-fluoro-3-methylphenol.
| Compound Name | 2-butan-2-yl-4,6-dichloro-5-fluoro-3-methylphenol |
|---|---|
| PubChem CID | 167081741 |
| Molecular Formula | C11H13Cl2FO |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-butan-2-yl-4,6-dichloro-5-fluoro-3-methylphenol |
| SMILES | CCC(C)c1c(C)c(Cl)c(F)c(Cl)c1O |
| InChI | InChI=1S/C11H13Cl2FO/c1-4-5(2)7-6(3)8(12)10(14)9(13)11(7)15/h5,15H,4H2,1-3H3 |
| InChIKey | UAGOPGSCASRBJY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|