C10H11ClF2O — CID 167152305
4-chloro-2,3-difluoro-6-methyl-5-propan-2-ylphenol (PubChem CID 167152305) has the molecular formula C10H11ClF2O and a molecular weight of 220.65 g/mol. Its IUPAC name is 4-chloro-2,3-difluoro-6-methyl-5-propan-2-ylphenol.
| Compound Name | 4-chloro-2,3-difluoro-6-methyl-5-propan-2-ylphenol |
|---|---|
| PubChem CID | 167152305 |
| Molecular Formula | C10H11ClF2O |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4-chloro-2,3-difluoro-6-methyl-5-propan-2-ylphenol |
| SMILES | Cc1c(O)c(F)c(F)c(Cl)c1C(C)C |
| InChI | InChI=1S/C10H11ClF2O/c1-4(2)6-5(3)10(14)9(13)8(12)7(6)11/h4,14H,1-3H3 |
| InChIKey | YIGSAXZJGYQGLW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|