C9H8Cl3FO — CID 156531016
2,3,4-trichloro-6-fluoro-5-propan-2-ylphenol (PubChem CID 156531016) has the molecular formula C9H8Cl3FO and a molecular weight of 257.52 g/mol. Its IUPAC name is 2,3,4-trichloro-6-fluoro-5-propan-2-ylphenol.
| Compound Name | 2,3,4-trichloro-6-fluoro-5-propan-2-ylphenol |
|---|---|
| PubChem CID | 156531016 |
| Molecular Formula | C9H8Cl3FO |
| Molecular Weight | 257.52 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 2,3,4-trichloro-6-fluoro-5-propan-2-ylphenol |
| SMILES | CC(C)c1c(F)c(O)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3FO/c1-3(2)4-5(10)6(11)7(12)9(14)8(4)13/h3,14H,1-2H3 |
| InChIKey | GHRAJLLIEMZLLF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|