C12H19NO4 — CID 163959970
5-(1-aminopropan-2-yloxy)-6-ethyl-3-methylbenzene-1,2,4-triol (PubChem CID 163959970) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-(1-aminopropan-2-yloxy)-6-ethyl-3-methylbenzene-1,2,4-triol.
| Compound Name | 5-(1-aminopropan-2-yloxy)-6-ethyl-3-methylbenzene-1,2,4-triol |
|---|---|
| PubChem CID | 163959970 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-(1-aminopropan-2-yloxy)-6-ethyl-3-methylbenzene-1,2,4-triol |
| SMILES | CCc1c(O)c(O)c(C)c(O)c1OC(C)CN |
| InChI | InChI=1S/C12H19NO4/c1-4-8-11(16)9(14)7(3)10(15)12(8)17-6(2)5-13/h6,14-16H,4-5,13H2,1-3H3 |
| InChIKey | SGPOYOCUZVOHDU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|