C12H16N2S — CID 177071250
1,4-di(propan-2-yl)thieno[3,4-d]pyridazine (PubChem CID 177071250) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)thieno[3,4-d]pyridazine.
| Compound Name | 1,4-di(propan-2-yl)thieno[3,4-d]pyridazine |
|---|---|
| PubChem CID | 177071250 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1,4-di(propan-2-yl)thieno[3,4-d]pyridazine |
| SMILES | CC(C)c1nnc(C(C)C)c2cscc12 |
| InChI | InChI=1S/C12H16N2S/c1-7(2)11-9-5-15-6-10(9)12(8(3)4)14-13-11/h5-8H,1-4H3 |
| InChIKey | GAJVSBIGDOYKMS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |