C14H19FN2S — CID 176700940
4,7-ditert-butyl-3-fluorothieno[2,3-d]pyridazine (PubChem CID 176700940) has the molecular formula C14H19FN2S and a molecular weight of 266.38 g/mol. Its IUPAC name is 4,7-ditert-butyl-3-fluorothieno[2,3-d]pyridazine.
| Compound Name | 4,7-ditert-butyl-3-fluorothieno[2,3-d]pyridazine |
|---|---|
| PubChem CID | 176700940 |
| Molecular Formula | C14H19FN2S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4,7-ditert-butyl-3-fluorothieno[2,3-d]pyridazine |
| SMILES | CC(C)(C)c1nnc(C(C)(C)C)c2c(F)csc12 |
| InChI | InChI=1S/C14H19FN2S/c1-13(2,3)11-9-8(15)7-18-10(9)12(17-16-11)14(4,5)6/h7H,1-6H3 |
| InChIKey | CUZWDHYUAIZJEB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |