C9H10N2S — CID 89250457
7-ethyl-4-methylthieno[2,3-d]pyridazine (PubChem CID 89250457) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 7-ethyl-4-methylthieno[2,3-d]pyridazine.
| Compound Name | 7-ethyl-4-methylthieno[2,3-d]pyridazine |
|---|---|
| PubChem CID | 89250457 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 7-ethyl-4-methylthieno[2,3-d]pyridazine |
| SMILES | CCc1nnc(C)c2ccsc12 |
| InChI | InChI=1S/C9H10N2S/c1-3-8-9-7(4-5-12-9)6(2)10-11-8/h4-5H,3H2,1-2H3 |
| InChIKey | NNSMJAKKTJKVLX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |