About 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one
4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one (PubChem CID 66908669) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one.
Molecular Properties
| Compound Name | 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one |
| PubChem CID | 66908669 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one |
| SMILES | CC(C)c1nnnc2c1OCC(=O)N2 |
| InChI | InChI=1S/C8H10N4O2/c1-4(2)6-7-8(11-12-10-6)9-5(13)3-14-7/h4H,3H2,1-2H3,(H,9,10,11,13) |
| InChIKey | NIUKSRLBXHQWIE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one?
The IUPAC name of 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one (CID 66908669) is 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one.
What is the SMILES notation for 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one?
The canonical SMILES for 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one is CC(C)c1nnnc2c1OCC(=O)N2.
What is the InChIKey of 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one?
The InChIKey is NIUKSRLBXHQWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-4(2)6-7-8(11-12-10-6)9-5(13)3-14-7/h4H,3H2,1-2H3,(H,9,10,11,13).
What are the key properties of 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one?
4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one has a molecular weight of 194.19 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-8H-[1,4]oxazino[3,2-d]triazin-7-one is sourced from PubChem (CID 66908669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).