C25H21N4O2P — CID 14638232
2-methyl-4-[(triphenyl-lambda5-phosphanylidene)amino]-8H-pyrimido[5,4-b][1,4]oxazin-7-one (PubChem CID 14638232) has the molecular formula C25H21N4O2P and a molecular weight of 440.44 g/mol. Its IUPAC name is 2-methyl-4-[(triphenyl-lambda5-phosphanylidene)amino]-8H-pyrimido[5,4-b][1,4]oxazin-7-one.
| Compound Name | 2-methyl-4-[(triphenyl-lambda5-phosphanylidene)amino]-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
|---|---|
| PubChem CID | 14638232 |
| Molecular Formula | C25H21N4O2P |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-methyl-4-[(triphenyl-lambda5-phosphanylidene)amino]-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
| SMILES | Cc1nc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c2c(n1)NC(=O)CO2 |
| InChI | InChI=1S/C25H21N4O2P/c1-18-26-24-23(31-17-22(30)28-24)25(27-18)29-32(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16H,17H2,1H3,(H,26,27,28,30) |
| InChIKey | AYGPNHQLVSDZHH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|