C12H8ClNO2 — CID 121012100
5-chloro-4H-benzo[h][1,4]benzoxazin-3-one (PubChem CID 121012100) has the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. Its IUPAC name is 5-chloro-4H-benzo[h][1,4]benzoxazin-3-one.
| Compound Name | 5-chloro-4H-benzo[h][1,4]benzoxazin-3-one |
|---|---|
| PubChem CID | 121012100 |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 5-chloro-4H-benzo[h][1,4]benzoxazin-3-one |
| SMILES | O=C1COc2c(c(Cl)cc3ccccc23)N1 |
| InChI | InChI=1S/C12H8ClNO2/c13-9-5-7-3-1-2-4-8(7)12-11(9)14-10(15)6-16-12/h1-5H,6H2,(H,14,15) |
| InChIKey | FBCNOIZIVREBMC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |