C8H6ClNO3 — CID 137370152
5-chloro-8-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 137370152) has the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. Its IUPAC name is 5-chloro-8-hydroxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 5-chloro-8-hydroxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 137370152 |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 5-chloro-8-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(O)ccc(Cl)c2N1 |
| InChI | InChI=1S/C8H6ClNO3/c9-4-1-2-5(11)8-7(4)10-6(12)3-13-8/h1-2,11H,3H2,(H,10,12) |
| InChIKey | TVMBBQDHOVCSTK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |