C8H4ClNO3 — CID 118636391
4-chloro-7-hydroxy-1H-indole-2,3-dione (PubChem CID 118636391) has the molecular formula C8H4ClNO3 and a molecular weight of 197.58 g/mol. Its IUPAC name is 4-chloro-7-hydroxy-1H-indole-2,3-dione.
| Compound Name | 4-chloro-7-hydroxy-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 118636391 |
| Molecular Formula | C8H4ClNO3 |
| Molecular Weight | 197.58 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 4-chloro-7-hydroxy-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(O)ccc(Cl)c2C1=O |
| InChI | InChI=1S/C8H4ClNO3/c9-3-1-2-4(11)6-5(3)7(12)8(13)10-6/h1-2,11H,(H,10,12,13) |
| InChIKey | RDKYCCCDNSNIDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|