C11H7ClO3 — CID 71324480
5-chloro-8-hydroxy-2-methylnaphthalene-1,4-dione (PubChem CID 71324480) has the molecular formula C11H7ClO3 and a molecular weight of 222.63 g/mol. Its IUPAC name is 5-chloro-8-hydroxy-2-methylnaphthalene-1,4-dione.
| Compound Name | 5-chloro-8-hydroxy-2-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 71324480 |
| Molecular Formula | C11H7ClO3 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | 5-chloro-8-hydroxy-2-methylnaphthalene-1,4-dione |
| SMILES | CC1=CC(=O)c2c(Cl)ccc(O)c2C1=O |
| InChI | InChI=1S/C11H7ClO3/c1-5-4-8(14)9-6(12)2-3-7(13)10(9)11(5)15/h2-4,13H,1H3 |
| InChIKey | XJOLWRUFUHUART-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|