C17H14O4 — CID 14283285
9,10-dimethoxy-2-methylanthracene-1,4-dione (PubChem CID 14283285) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 9,10-dimethoxy-2-methylanthracene-1,4-dione.
| Compound Name | 9,10-dimethoxy-2-methylanthracene-1,4-dione |
|---|---|
| PubChem CID | 14283285 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 9,10-dimethoxy-2-methylanthracene-1,4-dione |
| SMILES | COc1c2c(c(OC)c3ccccc13)C(=O)C(C)=CC2=O |
| InChI | InChI=1S/C17H14O4/c1-9-8-12(18)13-14(15(9)19)17(21-3)11-7-5-4-6-10(11)16(13)20-2/h4-8H,1-3H3 |
| InChIKey | CGKURDDUNHIEID-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|