C13H13BrO3 — CID 11300943
6-bromo-4,7-dimethoxy-2,5-dimethylinden-1-one (PubChem CID 11300943) has the molecular formula C13H13BrO3 and a molecular weight of 297.15 g/mol. Its IUPAC name is 6-bromo-4,7-dimethoxy-2,5-dimethylinden-1-one.
| Compound Name | 6-bromo-4,7-dimethoxy-2,5-dimethylinden-1-one |
|---|---|
| PubChem CID | 11300943 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 6-bromo-4,7-dimethoxy-2,5-dimethylinden-1-one |
| SMILES | COc1c(C)c(Br)c(OC)c2c1C=C(C)C2=O |
| InChI | InChI=1S/C13H13BrO3/c1-6-5-8-9(11(6)15)13(17-4)10(14)7(2)12(8)16-3/h5H,1-4H3 |
| InChIKey | ZKELMFOJALBWSE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |