C14H15NO4 — CID 86084516
2-(diethylamino)-5,8-dihydroxynaphthalene-1,4-dione (PubChem CID 86084516) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(diethylamino)-5,8-dihydroxynaphthalene-1,4-dione.
| Compound Name | 2-(diethylamino)-5,8-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 86084516 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(diethylamino)-5,8-dihydroxynaphthalene-1,4-dione |
| SMILES | CCN(CC)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C14H15NO4/c1-3-15(4-2)8-7-11(18)12-9(16)5-6-10(17)13(12)14(8)19/h5-7,16-17H,3-4H2,1-2H3 |
| InChIKey | VXIOKIZMINFNLT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|