C12H7BrO4 — CID 139659365
5-acetyl-2-bromo-8-hydroxynaphthalene-1,4-dione (PubChem CID 139659365) has the molecular formula C12H7BrO4 and a molecular weight of 295.09 g/mol. Its IUPAC name is 5-acetyl-2-bromo-8-hydroxynaphthalene-1,4-dione.
| Compound Name | 5-acetyl-2-bromo-8-hydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 139659365 |
| Molecular Formula | C12H7BrO4 |
| Molecular Weight | 295.09 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 5-acetyl-2-bromo-8-hydroxynaphthalene-1,4-dione |
| SMILES | CC(=O)c1ccc(O)c2c1C(=O)C=C(Br)C2=O |
| InChI | InChI=1S/C12H7BrO4/c1-5(14)6-2-3-8(15)11-10(6)9(16)4-7(13)12(11)17/h2-4,15H,1H3 |
| InChIKey | SBTCXAOUEIRGQQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.09 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|