C18H14BrNO6S — CID 44571094
4-bromo-N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)ethyl]benzenesulfonamide (PubChem CID 44571094) has the molecular formula C18H14BrNO6S and a molecular weight of 452.28 g/mol. Its IUPAC name is 4-bromo-N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 44571094 |
| Molecular Formula | C18H14BrNO6S |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | 4-bromo-N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(Br)cc1)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C18H14BrNO6S/c1-9(20-27(25,26)11-4-2-10(19)3-5-11)12-8-15(23)16-13(21)6-7-14(22)17(16)18(12)24/h2-9,20-22H,1H3 |
| InChIKey | XXGQHFNSUZESDR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|