C20H18FNO6S — CID 44570925
N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-2-methylpropyl]-4-fluorobenzenesulfonamide (PubChem CID 44570925) has the molecular formula C20H18FNO6S and a molecular weight of 419.43 g/mol. Its IUPAC name is N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-2-methylpropyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-2-methylpropyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44570925 |
| Molecular Formula | C20H18FNO6S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-2-methylpropyl]-4-fluorobenzenesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(F)cc1)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C20H18FNO6S/c1-10(2)19(22-29(27,28)12-5-3-11(21)4-6-12)13-9-16(25)17-14(23)7-8-15(24)18(17)20(13)26/h3-10,19,22-24H,1-2H3 |
| InChIKey | XAPLLSJWCYNZEZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|