C19H25FN2O2S — CID 99796852
4-[(dimethylamino)methyl]-N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]benzenesulfonamide (PubChem CID 99796852) has the molecular formula C19H25FN2O2S and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]benzenesulfonamide.
| Compound Name | 4-[(dimethylamino)methyl]-N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 99796852 |
| Molecular Formula | C19H25FN2O2S |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]benzenesulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(CN(C)C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN2O2S/c1-14(2)19(16-7-9-17(20)10-8-16)21-25(23,24)18-11-5-15(6-12-18)13-22(3)4/h5-12,14,19,21H,13H2,1-4H3/t19-/m0/s1 |
| InChIKey | BUJFHMIPUDWUEY-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |