C11H16FNO2S — CID 47121983
N-[1-(4-fluorophenyl)-2-methylpropyl]methanesulfonamide (PubChem CID 47121983) has the molecular formula C11H16FNO2S and a molecular weight of 245.32 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-methylpropyl]methanesulfonamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-methylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 47121983 |
| Molecular Formula | C11H16FNO2S |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-methylpropyl]methanesulfonamide |
| SMILES | CC(C)C(NS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H16FNO2S/c1-8(2)11(13-16(3,14)15)9-4-6-10(12)7-5-9/h4-8,11,13H,1-3H3 |
| InChIKey | BSMLTMHHKZDIEK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |