C11H18FN — CID 163403663
ethane;1-(4-fluorophenyl)-N,N-dimethylmethanamine (PubChem CID 163403663) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is ethane;1-(4-fluorophenyl)-N,N-dimethylmethanamine.
| Compound Name | ethane;1-(4-fluorophenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 163403663 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | ethane;1-(4-fluorophenyl)-N,N-dimethylmethanamine |
| SMILES | CC.CN(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C9H12FN.C2H6/c1-11(2)7-8-3-5-9(10)6-4-8;1-2/h3-6H,7H2,1-2H3;1-2H3 |
| InChIKey | IAZLHTPYSBXTKH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |