C13H23N — CID 143652476
ethane;1-(4-ethylphenyl)-N,N-dimethylmethanamine (PubChem CID 143652476) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is ethane;1-(4-ethylphenyl)-N,N-dimethylmethanamine.
| Compound Name | ethane;1-(4-ethylphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 143652476 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | ethane;1-(4-ethylphenyl)-N,N-dimethylmethanamine |
| SMILES | CC.CCc1ccc(CN(C)C)cc1 |
| InChI | InChI=1S/C11H17N.C2H6/c1-4-10-5-7-11(8-6-10)9-12(2)3;1-2/h5-8H,4,9H2,1-3H3;1-2H3 |
| InChIKey | RKILWNLGVYGSTG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |