C14H22FNO3S — CID 21078753
4-fluoro-N-(2-hydroxy-2,4-dimethylhexan-3-yl)benzenesulfonamide (PubChem CID 21078753) has the molecular formula C14H22FNO3S and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydroxy-2,4-dimethylhexan-3-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-hydroxy-2,4-dimethylhexan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21078753 |
| Molecular Formula | C14H22FNO3S |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-fluoro-N-(2-hydroxy-2,4-dimethylhexan-3-yl)benzenesulfonamide |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(F)cc1)C(C)(C)O |
| InChI | InChI=1S/C14H22FNO3S/c1-5-10(2)13(14(3,4)17)16-20(18,19)12-8-6-11(15)7-9-12/h6-10,13,16-17H,5H2,1-4H3 |
| InChIKey | TXPSKRJJVIRYIT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |