C18H26FNO3S — CID 68544690
4-fluoro-N-[(4S,5S)-3-hydroxy-2,5-dimethyl-3-prop-1-en-2-ylhept-1-en-4-yl]benzenesulfonamide (PubChem CID 68544690) has the molecular formula C18H26FNO3S and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-fluoro-N-[(4S,5S)-3-hydroxy-2,5-dimethyl-3-prop-1-en-2-ylhept-1-en-4-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(4S,5S)-3-hydroxy-2,5-dimethyl-3-prop-1-en-2-ylhept-1-en-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 68544690 |
| Molecular Formula | C18H26FNO3S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-fluoro-N-[(4S,5S)-3-hydroxy-2,5-dimethyl-3-prop-1-en-2-ylhept-1-en-4-yl]benzenesulfonamide |
| SMILES | C=C(C)C(O)(C(=C)C)[C@@H](NS(=O)(=O)c1ccc(F)cc1)[C@@H](C)CC |
| InChI | InChI=1S/C18H26FNO3S/c1-7-14(6)17(18(21,12(2)3)13(4)5)20-24(22,23)16-10-8-15(19)9-11-16/h8-11,14,17,20-21H,2,4,7H2,1,3,5-6H3/t14-,17-/m0/s1 |
| InChIKey | CAGHDZRBXCNTDV-YOEHRIQHSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|