C9H6BrCl2NO2 — CID 82234328
8-bromo-6,9-dichloro-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 82234328) has the molecular formula C9H6BrCl2NO2 and a molecular weight of 310.96 g/mol. Its IUPAC name is 8-bromo-6,9-dichloro-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 8-bromo-6,9-dichloro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82234328 |
| Molecular Formula | C9H6BrCl2NO2 |
| Molecular Weight | 310.96 g/mol |
| Exact Mass | 308.90 |
| IUPAC Name | 8-bromo-6,9-dichloro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | O=C1CCOc2c(Cl)c(Br)cc(Cl)c2N1 |
| InChI | InChI=1S/C9H6BrCl2NO2/c10-4-3-5(11)8-9(7(4)12)15-2-1-6(14)13-8/h3H,1-2H2,(H,13,14) |
| InChIKey | RLMBJNZKRZJWIW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.96 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|