C18H13ClN2O3 — CID 166458027
8-chloro-6-[(2-oxo-1H-quinolin-3-yl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 166458027) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 8-chloro-6-[(2-oxo-1H-quinolin-3-yl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-chloro-6-[(2-oxo-1H-quinolin-3-yl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 166458027 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 8-chloro-6-[(2-oxo-1H-quinolin-3-yl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(Cl)cc(Cc3cc4ccccc4[nH]c3=O)cc2N1 |
| InChI | InChI=1S/C18H13ClN2O3/c19-13-6-10(7-15-17(13)24-9-16(22)20-15)5-12-8-11-3-1-2-4-14(11)21-18(12)23/h1-4,6-8H,5,9H2,(H,20,22)(H,21,23) |
| InChIKey | SBGKTTWGQJLWEK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |