C21H22N2O2 — CID 166457788
ethane;3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-1H-quinolin-2-one (PubChem CID 166457788) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethane;3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-1H-quinolin-2-one.
| Compound Name | ethane;3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166457788 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethane;3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-1H-quinolin-2-one |
| SMILES | CC.O=C1CCc2cc(Cc3cc4ccccc4[nH]c3=O)ccc2N1 |
| InChI | InChI=1S/C19H16N2O2.C2H6/c22-18-8-6-14-9-12(5-7-17(14)20-18)10-15-11-13-3-1-2-4-16(13)21-19(15)23;1-2/h1-5,7,9,11H,6,8,10H2,(H,20,22)(H,21,23);1-2H3 |
| InChIKey | CMNOLXCQKMIVGI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |