C20H18N2O2 — CID 166457969
3-[(2-acetyl-1,3-dihydroisoindol-5-yl)methyl]-1H-quinolin-2-one (PubChem CID 166457969) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[(2-acetyl-1,3-dihydroisoindol-5-yl)methyl]-1H-quinolin-2-one.
| Compound Name | 3-[(2-acetyl-1,3-dihydroisoindol-5-yl)methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166457969 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-[(2-acetyl-1,3-dihydroisoindol-5-yl)methyl]-1H-quinolin-2-one |
| SMILES | CC(=O)N1Cc2ccc(Cc3cc4ccccc4[nH]c3=O)cc2C1 |
| InChI | InChI=1S/C20H18N2O2/c1-13(23)22-11-16-7-6-14(9-18(16)12-22)8-17-10-15-4-2-3-5-19(15)21-20(17)24/h2-7,9-10H,8,11-12H2,1H3,(H,21,24) |
| InChIKey | WVVVRRYBIPBJKK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |