C8H14N4 — CID 116823547
N,3-dimethyl-6-propan-2-yl-1,2,4-triazin-5-amine (PubChem CID 116823547) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N,3-dimethyl-6-propan-2-yl-1,2,4-triazin-5-amine.
| Compound Name | N,3-dimethyl-6-propan-2-yl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823547 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N,3-dimethyl-6-propan-2-yl-1,2,4-triazin-5-amine |
| SMILES | CNc1nc(C)nnc1C(C)C |
| InChI | InChI=1S/C8H14N4/c1-5(2)7-8(9-4)10-6(3)11-12-7/h5H,1-4H3,(H,9,10,11) |
| InChIKey | JTZFXEOWNJRCPV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |