C7H12N4O — CID 82455314
6-methoxy-4-N,2-dimethylpyrimidine-4,5-diamine (PubChem CID 82455314) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 6-methoxy-4-N,2-dimethylpyrimidine-4,5-diamine.
| Compound Name | 6-methoxy-4-N,2-dimethylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455314 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 6-methoxy-4-N,2-dimethylpyrimidine-4,5-diamine |
| SMILES | CNc1nc(C)nc(OC)c1N |
| InChI | InChI=1S/C7H12N4O/c1-4-10-6(9-2)5(8)7(11-4)12-3/h8H2,1-3H3,(H,9,10,11) |
| InChIKey | OVHAHDOIPSEGCH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |