C7H13N5O3 — CID 144603065
4-N-methyl-6-(methylperoxymethoxy)pyrimidine-2,4,5-triamine (PubChem CID 144603065) has the molecular formula C7H13N5O3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 4-N-methyl-6-(methylperoxymethoxy)pyrimidine-2,4,5-triamine.
| Compound Name | 4-N-methyl-6-(methylperoxymethoxy)pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 144603065 |
| Molecular Formula | C7H13N5O3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 4-N-methyl-6-(methylperoxymethoxy)pyrimidine-2,4,5-triamine |
| SMILES | CNc1nc(N)nc(OCOOC)c1N |
| InChI | InChI=1S/C7H13N5O3/c1-10-5-4(8)6(12-7(9)11-5)14-3-15-13-2/h3,8H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | ICKAXQZLXYJAFY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|