C7H13N5 — CID 21059252
4-N,6-N,2-trimethylpyrimidine-4,5,6-triamine (PubChem CID 21059252) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 4-N,6-N,2-trimethylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N,2-trimethylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 21059252 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 4-N,6-N,2-trimethylpyrimidine-4,5,6-triamine |
| SMILES | CNc1nc(C)nc(NC)c1N |
| InChI | InChI=1S/C7H13N5/c1-4-11-6(9-2)5(8)7(10-3)12-4/h8H2,1-3H3,(H2,9,10,11,12) |
| InChIKey | NCBUQXBVXVADEP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |