C10H17N3 — CID 144749797
5-methyl-3,6-di(propan-2-yl)-1,2,4-triazine (PubChem CID 144749797) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-methyl-3,6-di(propan-2-yl)-1,2,4-triazine.
| Compound Name | 5-methyl-3,6-di(propan-2-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 144749797 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-methyl-3,6-di(propan-2-yl)-1,2,4-triazine |
| SMILES | Cc1nc(C(C)C)nnc1C(C)C |
| InChI | InChI=1S/C10H17N3/c1-6(2)9-8(5)11-10(7(3)4)13-12-9/h6-7H,1-5H3 |
| InChIKey | OKSPGSCWZDKCOS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |