C28H46N2 — CID 159916628
3,5-dimethyl-4,6-di(propan-2-yl)pyridazine;1,2,3,5-tetramethyl-4,6-di(propan-2-yl)benzene (PubChem CID 159916628) has the molecular formula C28H46N2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 3,5-dimethyl-4,6-di(propan-2-yl)pyridazine;1,2,3,5-tetramethyl-4,6-di(propan-2-yl)benzene.
| Compound Name | 3,5-dimethyl-4,6-di(propan-2-yl)pyridazine;1,2,3,5-tetramethyl-4,6-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 159916628 |
| Molecular Formula | C28H46N2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | 3,5-dimethyl-4,6-di(propan-2-yl)pyridazine;1,2,3,5-tetramethyl-4,6-di(propan-2-yl)benzene |
| SMILES | Cc1c(C)c(C(C)C)c(C)c(C(C)C)c1C.Cc1nnc(C(C)C)c(C)c1C(C)C |
| InChI | InChI=1S/C16H26.C12H20N2/c1-9(2)15-12(6)11(5)13(7)16(10(3)4)14(15)8;1-7(2)11-9(5)12(8(3)4)14-13-10(11)6/h9-10H,1-8H3;7-8H,1-6H3 |
| InChIKey | NXWCBTYCDPXZKW-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |