C38H65N3 — CID 164992574
methane;2,3,4,5-tetramethyl-6-propan-2-ylpyridine;2,3,4,6-tetramethyl-5-propan-2-ylpyridine;2,3,5,6-tetramethyl-4-propan-2-ylpyridine (PubChem CID 164992574) has the molecular formula C38H65N3 and a molecular weight of 563.96 g/mol. Its IUPAC name is methane;2,3,4,5-tetramethyl-6-propan-2-ylpyridine;2,3,4,6-tetramethyl-5-propan-2-ylpyridine;2,3,5,6-tetramethyl-4-propan-2-ylpyridine.
| Compound Name | methane;2,3,4,5-tetramethyl-6-propan-2-ylpyridine;2,3,4,6-tetramethyl-5-propan-2-ylpyridine;2,3,5,6-tetramethyl-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 164992574 |
| Molecular Formula | C38H65N3 |
| Molecular Weight | 563.96 g/mol |
| Exact Mass | 563.52 |
| IUPAC Name | methane;2,3,4,5-tetramethyl-6-propan-2-ylpyridine;2,3,4,6-tetramethyl-5-propan-2-ylpyridine;2,3,5,6-tetramethyl-4-propan-2-ylpyridine |
| SMILES | C.C.Cc1nc(C(C)C)c(C)c(C)c1C.Cc1nc(C)c(C(C)C)c(C)c1C.Cc1nc(C)c(C)c(C(C)C)c1C |
| InChI | InChI=1S/3C12H19N.2CH4/c1-7(2)12-8(3)10(5)13-11(6)9(12)4;1-7(2)12-9(4)8(3)10(5)13-11(12)6;1-7(2)12-10(5)8(3)9(4)11(6)13-12;;/h3*7H,1-6H3;2*1H4 |
| InChIKey | HBLMYMJSRANYLL-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.96 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |