C18H25N — CID 157183613
2,3,4,5,6,7-hexamethyl-8-propan-2-ylquinoline (PubChem CID 157183613) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexamethyl-8-propan-2-ylquinoline.
| Compound Name | 2,3,4,5,6,7-hexamethyl-8-propan-2-ylquinoline |
|---|---|
| PubChem CID | 157183613 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 2,3,4,5,6,7-hexamethyl-8-propan-2-ylquinoline |
| SMILES | Cc1nc2c(C(C)C)c(C)c(C)c(C)c2c(C)c1C |
| InChI | InChI=1S/C18H25N/c1-9(2)16-12(5)10(3)13(6)17-14(7)11(4)15(8)19-18(16)17/h9H,1-8H3 |
| InChIKey | JZXQVYCMKBJMJH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |