C12H20N2 — CID 148912729
3,6-dimethyl-4,5-di(propan-2-yl)pyridazine (PubChem CID 148912729) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3,6-dimethyl-4,5-di(propan-2-yl)pyridazine.
| Compound Name | 3,6-dimethyl-4,5-di(propan-2-yl)pyridazine |
|---|---|
| PubChem CID | 148912729 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3,6-dimethyl-4,5-di(propan-2-yl)pyridazine |
| SMILES | Cc1nnc(C)c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C12H20N2/c1-7(2)11-9(5)13-14-10(6)12(11)8(3)4/h7-8H,1-6H3 |
| InChIKey | PIYKYBDRZZKDMG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |