C7H5BrF3NO — CID 169248960
3-bromo-6-methyl-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 169248960) has the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. Its IUPAC name is 3-bromo-6-methyl-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-bromo-6-methyl-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 169248960 |
| Molecular Formula | C7H5BrF3NO |
| Molecular Weight | 256.02 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | 3-bromo-6-methyl-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C7H5BrF3NO/c1-3-4(7(9,10)11)2-5(8)6(13)12-3/h2H,1H3,(H,12,13) |
| InChIKey | HUFIOLFLYQARJP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |