C8H5F6NO — CID 173379056
6-methyl-3,4-bis(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 173379056) has the molecular formula C8H5F6NO and a molecular weight of 245.12 g/mol. Its IUPAC name is 6-methyl-3,4-bis(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-methyl-3,4-bis(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 173379056 |
| Molecular Formula | C8H5F6NO |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 6-methyl-3,4-bis(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(C(F)(F)F)c(C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H5F6NO/c1-3-2-4(7(9,10)11)5(6(16)15-3)8(12,13)14/h2H,1H3,(H,15,16) |
| InChIKey | WZKRMPWZNQBELN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |