C7H3BrF5NO — CID 130110303
3-bromo-5-(difluoromethyl)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 130110303) has the molecular formula C7H3BrF5NO and a molecular weight of 292.00 g/mol. Its IUPAC name is 3-bromo-5-(difluoromethyl)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-bromo-5-(difluoromethyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130110303 |
| Molecular Formula | C7H3BrF5NO |
| Molecular Weight | 292.00 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 3-bromo-5-(difluoromethyl)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)(F)F)c(C(F)F)cc1Br |
| InChI | InChI=1S/C7H3BrF5NO/c8-3-1-2(5(9)10)4(7(11,12)13)14-6(3)15/h1,5H,(H,14,15) |
| InChIKey | PHKYFBGGWBGFDR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.00 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |