C8H5BrF2N2O — CID 130110337
2-[5-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetonitrile (PubChem CID 130110337) has the molecular formula C8H5BrF2N2O and a molecular weight of 263.04 g/mol. Its IUPAC name is 2-[5-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetonitrile.
| Compound Name | 2-[5-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 130110337 |
| Molecular Formula | C8H5BrF2N2O |
| Molecular Weight | 263.04 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 2-[5-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-2-yl]acetonitrile |
| SMILES | N#CCc1[nH]c(=O)c(Br)cc1C(F)F |
| InChI | InChI=1S/C8H5BrF2N2O/c9-5-3-4(7(10)11)6(1-2-12)13-8(5)14/h3,7H,1H2,(H,13,14) |
| InChIKey | QRFVLVDGXVFCSS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.04 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |