C8H5F2N3O3 — CID 130084342
2-[5-(difluoromethyl)-2-nitro-6-oxo-1H-pyridin-3-yl]acetonitrile (PubChem CID 130084342) has the molecular formula C8H5F2N3O3 and a molecular weight of 229.14 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-2-nitro-6-oxo-1H-pyridin-3-yl]acetonitrile.
| Compound Name | 2-[5-(difluoromethyl)-2-nitro-6-oxo-1H-pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 130084342 |
| Molecular Formula | C8H5F2N3O3 |
| Molecular Weight | 229.14 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-[5-(difluoromethyl)-2-nitro-6-oxo-1H-pyridin-3-yl]acetonitrile |
| SMILES | N#CCc1cc(C(F)F)c(=O)[nH]c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5F2N3O3/c9-6(10)5-3-4(1-2-11)7(13(15)16)12-8(5)14/h3,6H,1H2,(H,12,14) |
| InChIKey | CFJSDICDRYKSBW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.14 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|