C6H5BrF2N2O — CID 130101701
5-amino-3-bromo-6-(difluoromethyl)-1H-pyridin-2-one (PubChem CID 130101701) has the molecular formula C6H5BrF2N2O and a molecular weight of 239.02 g/mol. Its IUPAC name is 5-amino-3-bromo-6-(difluoromethyl)-1H-pyridin-2-one.
| Compound Name | 5-amino-3-bromo-6-(difluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130101701 |
| Molecular Formula | C6H5BrF2N2O |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 5-amino-3-bromo-6-(difluoromethyl)-1H-pyridin-2-one |
| SMILES | Nc1cc(Br)c(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C6H5BrF2N2O/c7-2-1-3(10)4(5(8)9)11-6(2)12/h1,5H,10H2,(H,11,12) |
| InChIKey | KTWIRNQPTKQYBT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |