C7H6F3NO — CID 130079289
6-(difluoromethyl)-5-fluoro-3-methyl-1H-pyridin-2-one (PubChem CID 130079289) has the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-fluoro-3-methyl-1H-pyridin-2-one.
| Compound Name | 6-(difluoromethyl)-5-fluoro-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130079289 |
| Molecular Formula | C7H6F3NO |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 6-(difluoromethyl)-5-fluoro-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(F)c(C(F)F)[nH]c1=O |
| InChI | InChI=1S/C7H6F3NO/c1-3-2-4(8)5(6(9)10)11-7(3)12/h2,6H,1H3,(H,11,12) |
| InChIKey | HDJZRCOYHRTMRE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |