C8H6ClF2NO2 — CID 118814881
6-(difluoromethyl)-5-methyl-2-oxo-1H-pyridine-3-carbonyl chloride (PubChem CID 118814881) has the molecular formula C8H6ClF2NO2 and a molecular weight of 221.59 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-methyl-2-oxo-1H-pyridine-3-carbonyl chloride.
| Compound Name | 6-(difluoromethyl)-5-methyl-2-oxo-1H-pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 118814881 |
| Molecular Formula | C8H6ClF2NO2 |
| Molecular Weight | 221.59 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 6-(difluoromethyl)-5-methyl-2-oxo-1H-pyridine-3-carbonyl chloride |
| SMILES | Cc1cc(C(=O)Cl)c(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C8H6ClF2NO2/c1-3-2-4(6(9)13)8(14)12-5(3)7(10)11/h2,7H,1H3,(H,12,14) |
| InChIKey | HGHWRGKIMVQOKG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|