C7H5F2NO4 — CID 130100251
2-(difluoromethyl)-5-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 130100251) has the molecular formula C7H5F2NO4 and a molecular weight of 205.12 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-5-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130100251 |
| Molecular Formula | C7H5F2NO4 |
| Molecular Weight | 205.12 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 2-(difluoromethyl)-5-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(O)c(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C7H5F2NO4/c8-5(9)4-2(7(13)14)1-3(11)6(12)10-4/h1,5,11H,(H,10,12)(H,13,14) |
| InChIKey | GVTUVGXAOGPISH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |