C11H15F2NO2 — CID 165441235
2-(difluoromethyl)-5-(2-methylbutan-2-yl)-1H-pyrrole-3-carboxylic acid (PubChem CID 165441235) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-(2-methylbutan-2-yl)-1H-pyrrole-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-5-(2-methylbutan-2-yl)-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 165441235 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-(difluoromethyl)-5-(2-methylbutan-2-yl)-1H-pyrrole-3-carboxylic acid |
| SMILES | CCC(C)(C)c1cc(C(=O)O)c(C(F)F)[nH]1 |
| InChI | InChI=1S/C11H15F2NO2/c1-4-11(2,3)7-5-6(10(15)16)8(14-7)9(12)13/h5,9,14H,4H2,1-3H3,(H,15,16) |
| InChIKey | IPSKJSGOXJBYIJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |