C7H4F3NO3 — CID 130079672
5-(difluoromethyl)-2-fluoro-6-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 130079672) has the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. Its IUPAC name is 5-(difluoromethyl)-2-fluoro-6-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-2-fluoro-6-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130079672 |
| Molecular Formula | C7H4F3NO3 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 5-(difluoromethyl)-2-fluoro-6-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)F)c(=O)[nH]c1F |
| InChI | InChI=1S/C7H4F3NO3/c8-4(9)2-1-3(7(13)14)5(10)11-6(2)12/h1,4H,(H,11,12)(H,13,14) |
| InChIKey | NTPAQTOZVQVRAP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|